C24H21N3O4S — CID 90656660
N-[8-amino-3-(3,5-dimethylanilino)-1,4-dioxonaphthalen-2-yl]benzenesulfonamide (PubChem CID 90656660) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[8-amino-3-(3,5-dimethylanilino)-1,4-dioxonaphthalen-2-yl]benzenesulfonamide.
| Compound Name | N-[8-amino-3-(3,5-dimethylanilino)-1,4-dioxonaphthalen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90656660 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[8-amino-3-(3,5-dimethylanilino)-1,4-dioxonaphthalen-2-yl]benzenesulfonamide |
| SMILES | Cc1cc(C)cc(NC2=C(NS(=O)(=O)c3ccccc3)C(=O)c3c(N)cccc3C2=O)c1 |
| InChI | InChI=1S/C24H21N3O4S/c1-14-11-15(2)13-16(12-14)26-21-22(27-32(30,31)17-7-4-3-5-8-17)24(29)20-18(23(21)28)9-6-10-19(20)25/h3-13,26-27H,25H2,1-2H3 |
| InChIKey | BOXBWUSFXFNAAI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|