C18H18O5 — CID 23258621
[7-methoxy-6-(3-methylbut-2-enyl)-5,8-dioxonaphthalen-1-yl] acetate (PubChem CID 23258621) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is [7-methoxy-6-(3-methylbut-2-enyl)-5,8-dioxonaphthalen-1-yl] acetate.
| Compound Name | [7-methoxy-6-(3-methylbut-2-enyl)-5,8-dioxonaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 23258621 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [7-methoxy-6-(3-methylbut-2-enyl)-5,8-dioxonaphthalen-1-yl] acetate |
| SMILES | COC1=C(CC=C(C)C)C(=O)c2cccc(OC(C)=O)c2C1=O |
| InChI | InChI=1S/C18H18O5/c1-10(2)8-9-13-16(20)12-6-5-7-14(23-11(3)19)15(12)17(21)18(13)22-4/h5-8H,9H2,1-4H3 |
| InChIKey | UIFLKDVUAQGUFD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|