C21H20O8 — CID 154824436
2-[2-[3-(3-methylbut-2-enyl)-1,4-dioxonaphthalen-2-yl]oxy-2-oxoethyl]butanedioic acid (PubChem CID 154824436) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is 2-[2-[3-(3-methylbut-2-enyl)-1,4-dioxonaphthalen-2-yl]oxy-2-oxoethyl]butanedioic acid.
| Compound Name | 2-[2-[3-(3-methylbut-2-enyl)-1,4-dioxonaphthalen-2-yl]oxy-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 154824436 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-[2-[3-(3-methylbut-2-enyl)-1,4-dioxonaphthalen-2-yl]oxy-2-oxoethyl]butanedioic acid |
| SMILES | CC(C)=CCC1=C(OC(=O)CC(CC(=O)O)C(=O)O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20O8/c1-11(2)7-8-15-18(25)13-5-3-4-6-14(13)19(26)20(15)29-17(24)10-12(21(27)28)9-16(22)23/h3-7,12H,8-10H2,1-2H3,(H,22,23)(H,27,28) |
| InChIKey | FNOZDUDKGBSCES-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|