C24H27NO6 — CID 174169896
5-[4-(2-methoxyethylamino)butoxy]-2-(4-methoxyphenoxy)naphthalene-1,4-dione (PubChem CID 174169896) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 5-[4-(2-methoxyethylamino)butoxy]-2-(4-methoxyphenoxy)naphthalene-1,4-dione.
| Compound Name | 5-[4-(2-methoxyethylamino)butoxy]-2-(4-methoxyphenoxy)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 174169896 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 5-[4-(2-methoxyethylamino)butoxy]-2-(4-methoxyphenoxy)naphthalene-1,4-dione |
| SMILES | COCCNCCCCOc1cccc2c1C(=O)C=C(Oc1ccc(OC)cc1)C2=O |
| InChI | InChI=1S/C24H27NO6/c1-28-15-13-25-12-3-4-14-30-21-7-5-6-19-23(21)20(26)16-22(24(19)27)31-18-10-8-17(29-2)9-11-18/h5-11,16,25H,3-4,12-15H2,1-2H3 |
| InChIKey | QFRCIFQQPBOFPS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|