C34H22N4S — CID 148856781
4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenyl-1,3-benzothiazole (PubChem CID 148856781) has the molecular formula C34H22N4S and a molecular weight of 518.65 g/mol. Its IUPAC name is 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenyl-1,3-benzothiazole.
| Compound Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 148856781 |
| Molecular Formula | C34H22N4S |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenyl-1,3-benzothiazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cccc5sc(-c6ccccc6)nc45)cc3)n2)cc1 |
| InChI | InChI=1S/C34H22N4S/c1-4-11-24(12-5-1)31-36-32(25-13-6-2-7-14-25)38-33(37-31)26-21-19-23(20-22-26)28-17-10-18-29-30(28)35-34(39-29)27-15-8-3-9-16-27/h1-22H |
| InChIKey | OYNHFZCEUPQKGR-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |