C40H26N4S — CID 170681559
4-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-2-phenyl-1,3-benzothiazole (PubChem CID 170681559) has the molecular formula C40H26N4S and a molecular weight of 594.74 g/mol. Its IUPAC name is 4-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-2-phenyl-1,3-benzothiazole.
| Compound Name | 4-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-2-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 170681559 |
| Molecular Formula | C40H26N4S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | 4-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-2-phenyl-1,3-benzothiazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc6sc(-c7ccccc7)nc56)c4)c3)n2)cc1 |
| InChI | InChI=1S/C40H26N4S/c1-4-13-27(14-5-1)37-42-38(28-15-6-2-7-16-28)44-39(43-37)33-22-11-20-31(26-33)30-19-10-21-32(25-30)34-23-12-24-35-36(34)41-40(45-35)29-17-8-3-9-18-29/h1-26H |
| InChIKey | DJWVLXIDYLSDTC-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |