C52H40N2 — CID 70909605
2,9-bis(2,5-dimethylphenyl)-4,7-bis(4-phenylphenyl)-1,10-phenanthroline (PubChem CID 70909605) has the molecular formula C52H40N2 and a molecular weight of 692.91 g/mol. Its IUPAC name is 2,9-bis(2,5-dimethylphenyl)-4,7-bis(4-phenylphenyl)-1,10-phenanthroline.
| Compound Name | 2,9-bis(2,5-dimethylphenyl)-4,7-bis(4-phenylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 70909605 |
| Molecular Formula | C52H40N2 |
| Molecular Weight | 692.91 g/mol |
| Exact Mass | 692.32 |
| IUPAC Name | 2,9-bis(2,5-dimethylphenyl)-4,7-bis(4-phenylphenyl)-1,10-phenanthroline |
| SMILES | Cc1ccc(C)c(-c2cc(-c3ccc(-c4ccccc4)cc3)c3ccc4c(-c5ccc(-c6ccccc6)cc5)cc(-c5cc(C)ccc5C)nc4c3n2)c1 |
| InChI | InChI=1S/C52H40N2/c1-33-15-17-35(3)45(29-33)49-31-47(41-23-19-39(20-24-41)37-11-7-5-8-12-37)43-27-28-44-48(42-25-21-40(22-26-42)38-13-9-6-10-14-38)32-50(54-52(44)51(43)53-49)46-30-34(2)16-18-36(46)4/h5-32H,1-4H3 |
| InChIKey | LULFSTBXOAPBIU-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.91 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|