C42H36N2 — CID 22972089
4,7-diphenyl-2,9-bis(3,4,5-trimethylphenyl)-1,10-phenanthroline (PubChem CID 22972089) has the molecular formula C42H36N2 and a molecular weight of 568.76 g/mol. Its IUPAC name is 4,7-diphenyl-2,9-bis(3,4,5-trimethylphenyl)-1,10-phenanthroline.
| Compound Name | 4,7-diphenyl-2,9-bis(3,4,5-trimethylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 22972089 |
| Molecular Formula | C42H36N2 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 4,7-diphenyl-2,9-bis(3,4,5-trimethylphenyl)-1,10-phenanthroline |
| SMILES | Cc1cc(-c2cc(-c3ccccc3)c3ccc4c(-c5ccccc5)cc(-c5cc(C)c(C)c(C)c5)nc4c3n2)cc(C)c1C |
| InChI | InChI=1S/C42H36N2/c1-25-19-33(20-26(2)29(25)5)39-23-37(31-13-9-7-10-14-31)35-17-18-36-38(32-15-11-8-12-16-32)24-40(44-42(36)41(35)43-39)34-21-27(3)30(6)28(4)22-34/h7-24H,1-6H3 |
| InChIKey | UPJSIKGCFCXXKF-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|