About 2-(4-methyl-2,6-diphenylphenyl)aniline
2-(4-methyl-2,6-diphenylphenyl)aniline (PubChem CID 102107876) has the molecular formula C25H21N
and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-(4-methyl-2,6-diphenylphenyl)aniline.
Molecular Properties
| Compound Name | 2-(4-methyl-2,6-diphenylphenyl)aniline |
| PubChem CID | 102107876 |
| Molecular Formula | C25H21N |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-(4-methyl-2,6-diphenylphenyl)aniline |
| SMILES | Cc1cc(-c2ccccc2)c(-c2ccccc2N)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H21N/c1-18-16-22(19-10-4-2-5-11-19)25(21-14-8-9-15-24(21)26)23(17-18)20-12-6-3-7-13-20/h2-17H,26H2,1H3 |
| InChIKey | RRTCPTUPDBIKRW-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-2,6-diphenylphenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-2,6-diphenylphenyl)aniline?
The IUPAC name of 2-(4-methyl-2,6-diphenylphenyl)aniline (CID 102107876) is 2-(4-methyl-2,6-diphenylphenyl)aniline.
What is the SMILES notation for 2-(4-methyl-2,6-diphenylphenyl)aniline?
The canonical SMILES for 2-(4-methyl-2,6-diphenylphenyl)aniline is Cc1cc(-c2ccccc2)c(-c2ccccc2N)c(-c2ccccc2)c1.
What is the InChIKey of 2-(4-methyl-2,6-diphenylphenyl)aniline?
The InChIKey is RRTCPTUPDBIKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N/c1-18-16-22(19-10-4-2-5-11-19)25(21-14-8-9-15-24(21)26)23(17-18)20-12-6-3-7-13-20/h2-17H,26H2,1H3.
What are the key properties of 2-(4-methyl-2,6-diphenylphenyl)aniline?
2-(4-methyl-2,6-diphenylphenyl)aniline has a molecular weight of 335.45 g/mol, XLogP of 6.58, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-2,6-diphenylphenyl)aniline is sourced from PubChem (CID 102107876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).