C25H26N4 — CID 67882576
3-methyl-6-phenylbenzene-1,2-diamine;3-phenylbenzene-1,2-diamine (PubChem CID 67882576) has the molecular formula C25H26N4 and a molecular weight of 382.51 g/mol. Its IUPAC name is 3-methyl-6-phenylbenzene-1,2-diamine;3-phenylbenzene-1,2-diamine.
| Compound Name | 3-methyl-6-phenylbenzene-1,2-diamine;3-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 67882576 |
| Molecular Formula | C25H26N4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 3-methyl-6-phenylbenzene-1,2-diamine;3-phenylbenzene-1,2-diamine |
| SMILES | Cc1ccc(-c2ccccc2)c(N)c1N.Nc1cccc(-c2ccccc2)c1N |
| InChI | InChI=1S/C13H14N2.C12H12N2/c1-9-7-8-11(13(15)12(9)14)10-5-3-2-4-6-10;13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h2-8H,14-15H2,1H3;1-8H,13-14H2 |
| InChIKey | NYVIECDQLQLFQC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|