About 3-phenylbenzene-1,2-diamine;propane
3-phenylbenzene-1,2-diamine;propane (PubChem CID 70378466) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-phenylbenzene-1,2-diamine;propane.
Molecular Properties
| Compound Name | 3-phenylbenzene-1,2-diamine;propane |
| PubChem CID | 70378466 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3-phenylbenzene-1,2-diamine;propane |
| SMILES | CCC.Nc1cccc(-c2ccccc2)c1N |
| InChI | InChI=1S/C12H12N2.C3H8/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-3-2/h1-8H,13-14H2;3H2,1-2H3 |
| InChIKey | HEIGGANLRWWLFE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylbenzene-1,2-diamine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbenzene-1,2-diamine;propane?
The IUPAC name of 3-phenylbenzene-1,2-diamine;propane (CID 70378466) is 3-phenylbenzene-1,2-diamine;propane.
What is the SMILES notation for 3-phenylbenzene-1,2-diamine;propane?
The canonical SMILES for 3-phenylbenzene-1,2-diamine;propane is CCC.Nc1cccc(-c2ccccc2)c1N.
What is the InChIKey of 3-phenylbenzene-1,2-diamine;propane?
The InChIKey is HEIGGANLRWWLFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C3H8/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-3-2/h1-8H,13-14H2;3H2,1-2H3.
What are the key properties of 3-phenylbenzene-1,2-diamine;propane?
3-phenylbenzene-1,2-diamine;propane has a molecular weight of 228.34 g/mol, XLogP of 3.93, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbenzene-1,2-diamine;propane is sourced from PubChem (CID 70378466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).