C30H24N2 — CID 121301752
3-[4-[3-(4-phenylphenyl)phenyl]phenyl]benzene-1,2-diamine (PubChem CID 121301752) has the molecular formula C30H24N2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-[4-[3-(4-phenylphenyl)phenyl]phenyl]benzene-1,2-diamine.
| Compound Name | 3-[4-[3-(4-phenylphenyl)phenyl]phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 121301752 |
| Molecular Formula | C30H24N2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-[4-[3-(4-phenylphenyl)phenyl]phenyl]benzene-1,2-diamine |
| SMILES | Nc1cccc(-c2ccc(-c3cccc(-c4ccc(-c5ccccc5)cc4)c3)cc2)c1N |
| InChI | InChI=1S/C30H24N2/c31-29-11-5-10-28(30(29)32)25-18-16-24(17-19-25)27-9-4-8-26(20-27)23-14-12-22(13-15-23)21-6-2-1-3-7-21/h1-20H,31-32H2 |
| InChIKey | BCXMVDRWSUVWMO-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|