C10H6N2S — CID 130778477
2-ethynyl-5-phenyl-1,3,4-thiadiazole (PubChem CID 130778477) has the molecular formula C10H6N2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-ethynyl-5-phenyl-1,3,4-thiadiazole.
| Compound Name | 2-ethynyl-5-phenyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130778477 |
| Molecular Formula | C10H6N2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 2-ethynyl-5-phenyl-1,3,4-thiadiazole |
| SMILES | C#Cc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C10H6N2S/c1-2-9-11-12-10(13-9)8-6-4-3-5-7-8/h1,3-7H |
| InChIKey | FYYOZRJNCUMABP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|