C10H10BrN3OS — CID 123928348
2-bromo-1-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethanol (PubChem CID 123928348) has the molecular formula C10H10BrN3OS and a molecular weight of 300.18 g/mol. Its IUPAC name is 2-bromo-1-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethanol.
| Compound Name | 2-bromo-1-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 123928348 |
| Molecular Formula | C10H10BrN3OS |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 2-bromo-1-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethanol |
| SMILES | OC(CBr)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C10H10BrN3OS/c11-6-8(15)12-10-14-13-9(16-10)7-4-2-1-3-5-7/h1-5,8,15H,6H2,(H,12,14) |
| InChIKey | DFJMRRRVFITMMX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|