C18H17N3O2S — CID 27991426
(2S)-2-phenoxy-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 27991426) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is (2S)-2-phenoxy-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | (2S)-2-phenoxy-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 27991426 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2S)-2-phenoxy-N-(5-phenyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CC[C@H](Oc1ccccc1)C(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H17N3O2S/c1-2-15(23-14-11-7-4-8-12-14)16(22)19-18-21-20-17(24-18)13-9-5-3-6-10-13/h3-12,15H,2H2,1H3,(H,19,21,22)/t15-/m0/s1 |
| InChIKey | AVSAIQWJERPGTM-HNNXBMFYSA-N |
| XLogP | 4.00 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |