C19H18ClN3O2S — CID 133235523
N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-2-(3-methylphenoxy)butanamide (PubChem CID 133235523) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-2-(3-methylphenoxy)butanamide.
| Compound Name | N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-2-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 133235523 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-2-(3-methylphenoxy)butanamide |
| SMILES | CCC(Oc1cccc(C)c1)C(=O)Nc1nnc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C19H18ClN3O2S/c1-3-16(25-15-6-4-5-12(2)11-15)17(24)21-19-23-22-18(26-19)13-7-9-14(20)10-8-13/h4-11,16H,3H2,1-2H3,(H,21,23,24) |
| InChIKey | ZJLPGXKAMBZRIY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |