C17H23N3O2S — CID 20778405
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-(3-methylphenoxy)butanamide (PubChem CID 20778405) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-(3-methylphenoxy)butanamide.
| Compound Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 20778405 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-(3-methylphenoxy)butanamide |
| SMILES | CCC(Oc1cccc(C)c1)C(=O)Nc1nnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C17H23N3O2S/c1-6-13(22-12-9-7-8-11(2)10-12)14(21)18-16-20-19-15(23-16)17(3,4)5/h7-10,13H,6H2,1-5H3,(H,18,20,21) |
| InChIKey | KNVBONCPOMGZNF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |