C13H16N4O2S — CID 20778440
N-(5-amino-1,3,4-thiadiazol-2-yl)-2-(3-methylphenoxy)butanamide (PubChem CID 20778440) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(5-amino-1,3,4-thiadiazol-2-yl)-2-(3-methylphenoxy)butanamide.
| Compound Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-2-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 20778440 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-2-(3-methylphenoxy)butanamide |
| SMILES | CCC(Oc1cccc(C)c1)C(=O)Nc1nnc(N)s1 |
| InChI | InChI=1S/C13H16N4O2S/c1-3-10(19-9-6-4-5-8(2)7-9)11(18)15-13-17-16-12(14)20-13/h4-7,10H,3H2,1-2H3,(H2,14,16)(H,15,17,18) |
| InChIKey | GQRATOQKWKREIK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |