C10H12N2S — CID 142010140
ethane;2-phenyl-1,3,4-thiadiazole (PubChem CID 142010140) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is ethane;2-phenyl-1,3,4-thiadiazole.
| Compound Name | ethane;2-phenyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 142010140 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | ethane;2-phenyl-1,3,4-thiadiazole |
| SMILES | CC.c1ccc(-c2nncs2)cc1 |
| InChI | InChI=1S/C8H6N2S.C2H6/c1-2-4-7(5-3-1)8-10-9-6-11-8;1-2/h1-6H;1-2H3 |
| InChIKey | KNYJBEXLQFTLPM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |