C8H5FN2S — CID 130052469
2-(3-fluorophenyl)-1,3,4-thiadiazole (PubChem CID 130052469) has the molecular formula C8H5FN2S and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(3-fluorophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130052469 |
| Molecular Formula | C8H5FN2S |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 2-(3-fluorophenyl)-1,3,4-thiadiazole |
| SMILES | Fc1cccc(-c2nncs2)c1 |
| InChI | InChI=1S/C8H5FN2S/c9-7-3-1-2-6(4-7)8-11-10-5-12-8/h1-5H |
| InChIKey | SSBJLBZYSSXTCG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |