C10H6FNOS — CID 123747540
5-(3-fluorophenyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 123747540) has the molecular formula C10H6FNOS and a molecular weight of 207.23 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 5-(3-fluorophenyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 123747540 |
| Molecular Formula | C10H6FNOS |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 5-(3-fluorophenyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1ncsc1-c1cccc(F)c1 |
| InChI | InChI=1S/C10H6FNOS/c11-8-3-1-2-7(4-8)10-9(5-13)12-6-14-10/h1-6H |
| InChIKey | XTWCLEKJCZAKIJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|