C18H11F2NO — CID 131870663
2,5-bis(3-fluorophenyl)pyridine-3-carbaldehyde (PubChem CID 131870663) has the molecular formula C18H11F2NO and a molecular weight of 295.29 g/mol. Its IUPAC name is 2,5-bis(3-fluorophenyl)pyridine-3-carbaldehyde.
| Compound Name | 2,5-bis(3-fluorophenyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 131870663 |
| Molecular Formula | C18H11F2NO |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2,5-bis(3-fluorophenyl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1cc(-c2cccc(F)c2)cnc1-c1cccc(F)c1 |
| InChI | InChI=1S/C18H11F2NO/c19-16-5-1-3-12(8-16)14-7-15(11-22)18(21-10-14)13-4-2-6-17(20)9-13/h1-11H |
| InChIKey | DBFQSCCISSVPLX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|