C17H15F4N3O — CID 142811564
5-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;2,2,2-trifluoro-N-methylethanamine (PubChem CID 142811564) has the molecular formula C17H15F4N3O and a molecular weight of 353.32 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;2,2,2-trifluoro-N-methylethanamine.
| Compound Name | 5-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;2,2,2-trifluoro-N-methylethanamine |
|---|---|
| PubChem CID | 142811564 |
| Molecular Formula | C17H15F4N3O |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 5-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;2,2,2-trifluoro-N-methylethanamine |
| SMILES | CNCC(F)(F)F.O=Cc1c[nH]c2ncc(-c3cccc(F)c3)cc12 |
| InChI | InChI=1S/C14H9FN2O.C3H6F3N/c15-12-3-1-2-9(4-12)10-5-13-11(8-18)7-17-14(13)16-6-10;1-7-2-3(4,5)6/h1-8H,(H,16,17);7H,2H2,1H3 |
| InChIKey | IPDSYRZAMANAQW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|