C19H13N3O — CID 122421773
3-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)benzaldehyde (PubChem CID 122421773) has the molecular formula C19H13N3O and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)benzaldehyde.
| Compound Name | 3-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 122421773 |
| Molecular Formula | C19H13N3O |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)benzaldehyde |
| SMILES | O=Cc1cccc(-c2cnc3[nH]cc(-c4ccncc4)c3c2)c1 |
| InChI | InChI=1S/C19H13N3O/c23-12-13-2-1-3-15(8-13)16-9-17-18(11-22-19(17)21-10-16)14-4-6-20-7-5-14/h1-12H,(H,21,22) |
| InChIKey | VKYFKHLBJDPKTQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|