C16H15N3O — CID 134806364
2-[5-(3-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]acetamide (PubChem CID 134806364) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-[5-(3-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]acetamide.
| Compound Name | 2-[5-(3-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 134806364 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-[5-(3-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]acetamide |
| SMILES | Cc1cccc(-c2cnc3[nH]cc(CC(N)=O)c3c2)c1 |
| InChI | InChI=1S/C16H15N3O/c1-10-3-2-4-11(5-10)12-6-14-13(7-15(17)20)9-19-16(14)18-8-12/h2-6,8-9H,7H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | DNXBLNBGNAOCHD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |