C18H21N2OP — CID 155462281
5-(3-dimethylphosphoryl-5-methylphenyl)-3-ethyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 155462281) has the molecular formula C18H21N2OP and a molecular weight of 312.35 g/mol. Its IUPAC name is 5-(3-dimethylphosphoryl-5-methylphenyl)-3-ethyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(3-dimethylphosphoryl-5-methylphenyl)-3-ethyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 155462281 |
| Molecular Formula | C18H21N2OP |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-(3-dimethylphosphoryl-5-methylphenyl)-3-ethyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCc1c[nH]c2ncc(-c3cc(C)cc(P(C)(C)=O)c3)cc12 |
| InChI | InChI=1S/C18H21N2OP/c1-5-13-10-19-18-17(13)9-15(11-20-18)14-6-12(2)7-16(8-14)22(3,4)21/h6-11H,5H2,1-4H3,(H,19,20) |
| InChIKey | GRZATPXALVOPCY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|