C18H21N2O2P — CID 155462244
[2-dimethylphosphoryl-4-(3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol (PubChem CID 155462244) has the molecular formula C18H21N2O2P and a molecular weight of 328.35 g/mol. Its IUPAC name is [2-dimethylphosphoryl-4-(3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol.
| Compound Name | [2-dimethylphosphoryl-4-(3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol |
|---|---|
| PubChem CID | 155462244 |
| Molecular Formula | C18H21N2O2P |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [2-dimethylphosphoryl-4-(3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]methanol |
| SMILES | CCc1c[nH]c2ncc(-c3ccc(CO)c(P(C)(C)=O)c3)cc12 |
| InChI | InChI=1S/C18H21N2O2P/c1-4-12-9-19-18-16(12)7-15(10-20-18)13-5-6-14(11-21)17(8-13)23(2,3)22/h5-10,21H,4,11H2,1-3H3,(H,19,20) |
| InChIKey | YRXVIDRILZDXPR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|