C17H16N4O — CID 166398526
3-ethyl-5-(7-methoxy-1H-indazol-3-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 166398526) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-ethyl-5-(7-methoxy-1H-indazol-3-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-ethyl-5-(7-methoxy-1H-indazol-3-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 166398526 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-ethyl-5-(7-methoxy-1H-indazol-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCc1c[nH]c2ncc(-c3n[nH]c4c(OC)cccc34)cc12 |
| InChI | InChI=1S/C17H16N4O/c1-3-10-8-18-17-13(10)7-11(9-19-17)15-12-5-4-6-14(22-2)16(12)21-20-15/h4-9H,3H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | VZZNXCQUOLMCBJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |