C10H9F3N2 — CID 134232979
3-ethyl-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 134232979) has the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. Its IUPAC name is 3-ethyl-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-ethyl-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 134232979 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-ethyl-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCc1c[nH]c2ncc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C10H9F3N2/c1-2-6-4-14-9-8(6)3-7(5-15-9)10(11,12)13/h3-5H,2H2,1H3,(H,14,15) |
| InChIKey | KVPIONGDNPIHOI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |