C12H17N2O+ — CID 148946012
(5-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyloxidanium (PubChem CID 148946012) has the molecular formula C12H17N2O+ and a molecular weight of 205.28 g/mol. Its IUPAC name is (5-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyloxidanium.
| Compound Name | (5-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyloxidanium |
|---|---|
| PubChem CID | 148946012 |
| Molecular Formula | C12H17N2O+ |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (5-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyloxidanium |
| SMILES | CC(C)(C)c1cnc2[nH]cc(C[OH2+])c2c1 |
| InChI | InChI=1S/C12H16N2O/c1-12(2,3)9-4-10-8(7-15)5-13-11(10)14-6-9/h4-6,15H,7H2,1-3H3,(H,13,14)/p+1 |
| InChIKey | POYJIQUHNIKEGW-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|