About propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 86639056) has the molecular formula C11H10F3N2O2-
and a molecular weight of 259.21 g/mol. Its IUPAC name is propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 86639056 |
| Molecular Formula | C11H10F3N2O2- |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCC(=O)[O-].FC(F)(F)c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H5F3N2.C3H6O2/c9-8(10,11)6-3-5-1-2-12-7(5)13-4-6;1-2-3(4)5/h1-4H,(H,12,13);2H2,1H3,(H,4,5)/p-1 |
| InChIKey | AWHVLNQSKYBGAP-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CID 86639056) is propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is CCC(=O)[O-].FC(F)(F)c1cnc2[nH]ccc2c1.
What is the InChIKey of propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is AWHVLNQSKYBGAP-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H5F3N2.C3H6O2/c9-8(10,11)6-3-5-1-2-12-7(5)13-4-6;1-2-3(4)5/h1-4H,(H,12,13);2H2,1H3,(H,4,5)/p-1.
What are the key properties of propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine?
propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 259.21 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanoate;5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 86639056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).