C17H19FN3P — CID 155462041
2-dimethylphosphanyl-6-(3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-3-fluoroaniline (PubChem CID 155462041) has the molecular formula C17H19FN3P and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-dimethylphosphanyl-6-(3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-3-fluoroaniline.
| Compound Name | 2-dimethylphosphanyl-6-(3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-3-fluoroaniline |
|---|---|
| PubChem CID | 155462041 |
| Molecular Formula | C17H19FN3P |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-dimethylphosphanyl-6-(3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-3-fluoroaniline |
| SMILES | CCc1c[nH]c2ncc(-c3ccc(F)c(P(C)C)c3N)cc12 |
| InChI | InChI=1S/C17H19FN3P/c1-4-10-8-20-17-13(10)7-11(9-21-17)12-5-6-14(18)16(15(12)19)22(2)3/h5-9H,4,19H2,1-3H3,(H,20,21) |
| InChIKey | WRBHLCKAZVGKRL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|