C21H17F2N3O2S — CID 58087397
2,4-difluoro-3-[[5-(3-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]aniline (PubChem CID 58087397) has the molecular formula C21H17F2N3O2S and a molecular weight of 413.45 g/mol. Its IUPAC name is 2,4-difluoro-3-[[5-(3-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]aniline.
| Compound Name | 2,4-difluoro-3-[[5-(3-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]aniline |
|---|---|
| PubChem CID | 58087397 |
| Molecular Formula | C21H17F2N3O2S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2,4-difluoro-3-[[5-(3-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]aniline |
| SMILES | CS(=O)(=O)c1cccc(-c2cnc3[nH]cc(Cc4c(F)ccc(N)c4F)c3c2)c1 |
| InChI | InChI=1S/C21H17F2N3O2S/c1-29(27,28)15-4-2-3-12(7-15)13-8-16-14(11-26-21(16)25-10-13)9-17-18(22)5-6-19(24)20(17)23/h2-8,10-11H,9,24H2,1H3,(H,25,26) |
| InChIKey | QLKPRPNYUWYOGU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|