C22H19F2N3O2 — CID 58086533
3-[[2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl]-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58086533) has the molecular formula C22H19F2N3O2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 3-[[2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl]-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[[2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl]-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58086533 |
| Molecular Formula | C22H19F2N3O2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3-[[2,6-difluoro-3-(2-methoxyethoxy)phenyl]methyl]-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COCCOc1ccc(F)c(Cc2c[nH]c3ncc(-c4cccnc4)cc23)c1F |
| InChI | InChI=1S/C22H19F2N3O2/c1-28-7-8-29-20-5-4-19(23)18(21(20)24)10-16-13-27-22-17(16)9-15(12-26-22)14-3-2-6-25-11-14/h2-6,9,11-13H,7-8,10H2,1H3,(H,26,27) |
| InChIKey | IIZJRDWNFXWRID-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|