C11H9F3N2 — CID 70642178
5-ethyl-3-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 70642178) has the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. Its IUPAC name is 5-ethyl-3-(trifluoromethyl)-1,6-naphthyridine.
| Compound Name | 5-ethyl-3-(trifluoromethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 70642178 |
| Molecular Formula | C11H9F3N2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 5-ethyl-3-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | CCc1nccc2ncc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C11H9F3N2/c1-2-9-8-5-7(11(12,13)14)6-16-10(8)3-4-15-9/h3-6H,2H2,1H3 |
| InChIKey | ZRGLENQFEXMTND-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |