C18H16ClNS — CID 90938185
5-(4-chlorophenyl)-4-ethyl-3-phenylthiophen-2-amine (PubChem CID 90938185) has the molecular formula C18H16ClNS and a molecular weight of 313.85 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-ethyl-3-phenylthiophen-2-amine.
| Compound Name | 5-(4-chlorophenyl)-4-ethyl-3-phenylthiophen-2-amine |
|---|---|
| PubChem CID | 90938185 |
| Molecular Formula | C18H16ClNS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 5-(4-chlorophenyl)-4-ethyl-3-phenylthiophen-2-amine |
| SMILES | CCc1c(-c2ccc(Cl)cc2)sc(N)c1-c1ccccc1 |
| InChI | InChI=1S/C18H16ClNS/c1-2-15-16(12-6-4-3-5-7-12)18(20)21-17(15)13-8-10-14(19)11-9-13/h3-11H,2,20H2,1H3 |
| InChIKey | YNRCBXZNSDLYLU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |