C18H14Cl2S — CID 11727323
3,4-bis(chloromethyl)-2,5-diphenylthiophene (PubChem CID 11727323) has the molecular formula C18H14Cl2S and a molecular weight of 333.28 g/mol. Its IUPAC name is 3,4-bis(chloromethyl)-2,5-diphenylthiophene.
| Compound Name | 3,4-bis(chloromethyl)-2,5-diphenylthiophene |
|---|---|
| PubChem CID | 11727323 |
| Molecular Formula | C18H14Cl2S |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 3,4-bis(chloromethyl)-2,5-diphenylthiophene |
| SMILES | ClCc1c(-c2ccccc2)sc(-c2ccccc2)c1CCl |
| InChI | InChI=1S/C18H14Cl2S/c19-11-15-16(12-20)18(14-9-5-2-6-10-14)21-17(15)13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | CZIGLAWPTTXELY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|