About 1,2-dichloroethane;1,4-diphenylbenzene
1,2-dichloroethane;1,4-diphenylbenzene (PubChem CID 174576673) has the molecular formula C20H18Cl2
and a molecular weight of 329.27 g/mol. Its IUPAC name is 1,2-dichloroethane;1,4-diphenylbenzene.
Molecular Properties
| Compound Name | 1,2-dichloroethane;1,4-diphenylbenzene |
| PubChem CID | 174576673 |
| Molecular Formula | C20H18Cl2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1,2-dichloroethane;1,4-diphenylbenzene |
| SMILES | ClCCCl.c1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H14.C2H4Cl2/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16;3-1-2-4/h1-14H;1-2H2 |
| InChIKey | QHPVVPODLLHQCW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloroethane;1,4-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloroethane;1,4-diphenylbenzene?
The IUPAC name of 1,2-dichloroethane;1,4-diphenylbenzene (CID 174576673) is 1,2-dichloroethane;1,4-diphenylbenzene.
What is the SMILES notation for 1,2-dichloroethane;1,4-diphenylbenzene?
The canonical SMILES for 1,2-dichloroethane;1,4-diphenylbenzene is ClCCCl.c1ccc(-c2ccc(-c3ccccc3)cc2)cc1.
What is the InChIKey of 1,2-dichloroethane;1,4-diphenylbenzene?
The InChIKey is QHPVVPODLLHQCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14.C2H4Cl2/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16;3-1-2-4/h1-14H;1-2H2.
What are the key properties of 1,2-dichloroethane;1,4-diphenylbenzene?
1,2-dichloroethane;1,4-diphenylbenzene has a molecular weight of 329.27 g/mol, XLogP of 6.48, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloroethane;1,4-diphenylbenzene is sourced from PubChem (CID 174576673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).