C20H18Cl2 — CID 174576673
1,2-dichloroethane;1,4-diphenylbenzene (PubChem CID 174576673) has the molecular formula C20H18Cl2 and a molecular weight of 329.27 g/mol. Its IUPAC name is 1,2-dichloroethane;1,4-diphenylbenzene.
| Compound Name | 1,2-dichloroethane;1,4-diphenylbenzene |
|---|---|
| PubChem CID | 174576673 |
| Molecular Formula | C20H18Cl2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1,2-dichloroethane;1,4-diphenylbenzene |
| SMILES | ClCCCl.c1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H14.C2H4Cl2/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16;3-1-2-4/h1-14H;1-2H2 |
| InChIKey | QHPVVPODLLHQCW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|