About 1,1'-biphenyl;3H-diazaphosphirene
1,1'-biphenyl;3H-diazaphosphirene (PubChem CID 146196746) has the molecular formula C12H11N2P
and a molecular weight of 214.21 g/mol. Its IUPAC name is 1,1'-biphenyl;3H-diazaphosphirene.
Molecular Properties
| Compound Name | 1,1'-biphenyl;3H-diazaphosphirene |
| PubChem CID | 146196746 |
| Molecular Formula | C12H11N2P |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1,1'-biphenyl;3H-diazaphosphirene |
| SMILES | N1=NP1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.HN2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-1/h1-10H;3H |
| InChIKey | XZOVUHQPROZPSR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;3H-diazaphosphirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;3H-diazaphosphirene?
The IUPAC name of 1,1'-biphenyl;3H-diazaphosphirene (CID 146196746) is 1,1'-biphenyl;3H-diazaphosphirene.
What is the SMILES notation for 1,1'-biphenyl;3H-diazaphosphirene?
The canonical SMILES for 1,1'-biphenyl;3H-diazaphosphirene is N1=NP1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;3H-diazaphosphirene?
The InChIKey is XZOVUHQPROZPSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.HN2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-1/h1-10H;3H.
What are the key properties of 1,1'-biphenyl;3H-diazaphosphirene?
1,1'-biphenyl;3H-diazaphosphirene has a molecular weight of 214.21 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;3H-diazaphosphirene is sourced from PubChem (CID 146196746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).