C21H15S2+ — CID 56696812
3,4,5-triphenyldithiol-1-ium (PubChem CID 56696812) has the molecular formula C21H15S2+ and a molecular weight of 331.49 g/mol. Its IUPAC name is 3,4,5-triphenyldithiol-1-ium.
| Compound Name | 3,4,5-triphenyldithiol-1-ium |
|---|---|
| PubChem CID | 56696812 |
| Molecular Formula | C21H15S2+ |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3,4,5-triphenyldithiol-1-ium |
| SMILES | c1ccc(-c2s[s+]c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15S2/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)22-23-21(19)18-14-8-3-9-15-18/h1-15H/q+1 |
| InChIKey | PVQQIIQXAPTHRZ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|