C11H10BrNS — CID 130090867
4-(bromomethyl)-2-methyl-5-phenyl-1,3-thiazole (PubChem CID 130090867) has the molecular formula C11H10BrNS and a molecular weight of 268.18 g/mol. Its IUPAC name is 4-(bromomethyl)-2-methyl-5-phenyl-1,3-thiazole.
| Compound Name | 4-(bromomethyl)-2-methyl-5-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 130090867 |
| Molecular Formula | C11H10BrNS |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | 4-(bromomethyl)-2-methyl-5-phenyl-1,3-thiazole |
| SMILES | Cc1nc(CBr)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C11H10BrNS/c1-8-13-10(7-12)11(14-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | GIIXOKVFDRVGNU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|