C12H12F3NS — CID 159404933
2,4-dimethyl-5-phenyl-1,3-thiazole;fluoroform (PubChem CID 159404933) has the molecular formula C12H12F3NS and a molecular weight of 259.30 g/mol. Its IUPAC name is 2,4-dimethyl-5-phenyl-1,3-thiazole;fluoroform.
| Compound Name | 2,4-dimethyl-5-phenyl-1,3-thiazole;fluoroform |
|---|---|
| PubChem CID | 159404933 |
| Molecular Formula | C12H12F3NS |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2,4-dimethyl-5-phenyl-1,3-thiazole;fluoroform |
| SMILES | Cc1nc(C)c(-c2ccccc2)s1.FC(F)F |
| InChI | InChI=1S/C11H11NS.CHF3/c1-8-11(13-9(2)12-8)10-6-4-3-5-7-10;2-1(3)4/h3-7H,1-2H3;1H |
| InChIKey | LNVGESXCXANROO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |