C23H18BrNS — CID 46947498
4-[(4-bromophenyl)-phenylmethyl]-2-methyl-5-phenyl-1,3-thiazole (PubChem CID 46947498) has the molecular formula C23H18BrNS and a molecular weight of 420.38 g/mol. Its IUPAC name is 4-[(4-bromophenyl)-phenylmethyl]-2-methyl-5-phenyl-1,3-thiazole.
| Compound Name | 4-[(4-bromophenyl)-phenylmethyl]-2-methyl-5-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 46947498 |
| Molecular Formula | C23H18BrNS |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 4-[(4-bromophenyl)-phenylmethyl]-2-methyl-5-phenyl-1,3-thiazole |
| SMILES | Cc1nc(C(c2ccccc2)c2ccc(Br)cc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C23H18BrNS/c1-16-25-22(23(26-16)19-10-6-3-7-11-19)21(17-8-4-2-5-9-17)18-12-14-20(24)15-13-18/h2-15,21H,1H3 |
| InChIKey | ZYAQAELFCBLSSJ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |