C13H12N4S — CID 114034068
2,4-dimethyl-5-(3-phenyl-1H-1,2,4-triazol-5-yl)-1,3-thiazole (PubChem CID 114034068) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2,4-dimethyl-5-(3-phenyl-1H-1,2,4-triazol-5-yl)-1,3-thiazole.
| Compound Name | 2,4-dimethyl-5-(3-phenyl-1H-1,2,4-triazol-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 114034068 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2,4-dimethyl-5-(3-phenyl-1H-1,2,4-triazol-5-yl)-1,3-thiazole |
| SMILES | Cc1nc(C)c(-c2nc(-c3ccccc3)n[nH]2)s1 |
| InChI | InChI=1S/C13H12N4S/c1-8-11(18-9(2)14-8)13-15-12(16-17-13)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,15,16,17) |
| InChIKey | GRETXUVINDVCTH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |