C12H11NOS — CID 59263615
1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)ethanone (PubChem CID 59263615) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 59263615 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1sc(C)nc1-c1ccccc1 |
| InChI | InChI=1S/C12H11NOS/c1-8(14)12-11(13-9(2)15-12)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | KNZKCCIJDYPVAE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |