About 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline
6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline (PubChem CID 122590004) has the molecular formula C20H15FN4
and a molecular weight of 330.37 g/mol. Its IUPAC name is 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline.
Molecular Properties
| Compound Name | 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline |
| PubChem CID | 122590004 |
| Molecular Formula | C20H15FN4 |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline |
| SMILES | Fc1cccc(-c2nn3c(c2-c2ccc4nccnc4c2)CCC3)c1 |
| InChI | InChI=1S/C20H15FN4/c21-15-4-1-3-14(11-15)20-19(18-5-2-10-25(18)24-20)13-6-7-16-17(12-13)23-9-8-22-16/h1,3-4,6-9,11-12H,2,5,10H2 |
| InChIKey | HPQVNYHJCPZTFS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline?
The IUPAC name of 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline (CID 122590004) is 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline.
What is the SMILES notation for 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline?
The canonical SMILES for 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline is Fc1cccc(-c2nn3c(c2-c2ccc4nccnc4c2)CCC3)c1.
What is the InChIKey of 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline?
The InChIKey is HPQVNYHJCPZTFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FN4/c21-15-4-1-3-14(11-15)20-19(18-5-2-10-25(18)24-20)13-6-7-16-17(12-13)23-9-8-22-16/h1,3-4,6-9,11-12H,2,5,10H2.
What are the key properties of 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline?
6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline has a molecular weight of 330.37 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3-fluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoxaline is sourced from PubChem (CID 122590004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).