C23H20F2N4O2 — CID 122589970
7-[2-(2,5-difluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-2-(2-methoxyethoxy)quinoxaline (PubChem CID 122589970) has the molecular formula C23H20F2N4O2 and a molecular weight of 422.44 g/mol. Its IUPAC name is 7-[2-(2,5-difluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-2-(2-methoxyethoxy)quinoxaline.
| Compound Name | 7-[2-(2,5-difluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-2-(2-methoxyethoxy)quinoxaline |
|---|---|
| PubChem CID | 122589970 |
| Molecular Formula | C23H20F2N4O2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 7-[2-(2,5-difluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]-2-(2-methoxyethoxy)quinoxaline |
| SMILES | COCCOc1cnc2ccc(-c3c(-c4cc(F)ccc4F)nn4c3CCC4)cc2n1 |
| InChI | InChI=1S/C23H20F2N4O2/c1-30-9-10-31-21-13-26-18-7-4-14(11-19(18)27-21)22-20-3-2-8-29(20)28-23(22)16-12-15(24)5-6-17(16)25/h4-7,11-13H,2-3,8-10H2,1H3 |
| InChIKey | NHIXAVPFSHFWOZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|