C22H14F2N4P2 — CID 58299262
[6-fluoro-3-[4-(7-fluoro-3-phosphanylquinoxalin-2-yl)phenyl]quinoxalin-2-yl]phosphane (PubChem CID 58299262) has the molecular formula C22H14F2N4P2 and a molecular weight of 434.33 g/mol. Its IUPAC name is [6-fluoro-3-[4-(7-fluoro-3-phosphanylquinoxalin-2-yl)phenyl]quinoxalin-2-yl]phosphane.
| Compound Name | [6-fluoro-3-[4-(7-fluoro-3-phosphanylquinoxalin-2-yl)phenyl]quinoxalin-2-yl]phosphane |
|---|---|
| PubChem CID | 58299262 |
| Molecular Formula | C22H14F2N4P2 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | [6-fluoro-3-[4-(7-fluoro-3-phosphanylquinoxalin-2-yl)phenyl]quinoxalin-2-yl]phosphane |
| SMILES | Fc1ccc2nc(P)c(-c3ccc(-c4nc5cc(F)ccc5nc4P)cc3)nc2c1 |
| InChI | InChI=1S/C22H14F2N4P2/c23-13-5-7-15-17(9-13)25-19(21(29)27-15)11-1-2-12(4-3-11)20-22(30)28-16-8-6-14(24)10-18(16)26-20/h1-10H,29-30H2 |
| InChIKey | OUIVJGGFYHURMB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|