C21H13F2N3O2 — CID 118453878
[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]carbamic acid (PubChem CID 118453878) has the molecular formula C21H13F2N3O2 and a molecular weight of 377.35 g/mol. Its IUPAC name is [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]carbamic acid.
| Compound Name | [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]carbamic acid |
|---|---|
| PubChem CID | 118453878 |
| Molecular Formula | C21H13F2N3O2 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [2,3-bis(4-fluorophenyl)quinoxalin-6-yl]carbamic acid |
| SMILES | O=C(O)Nc1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C21H13F2N3O2/c22-14-5-1-12(2-6-14)19-20(13-3-7-15(23)8-4-13)26-18-11-16(24-21(27)28)9-10-17(18)25-19/h1-11,24H,(H,27,28) |
| InChIKey | CBNDPMPZZAQKJY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |