About 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea
1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea (PubChem CID 170297200) has the molecular formula C24H20F2N4O
and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea |
| PubChem CID | 170297200 |
| Molecular Formula | C24H20F2N4O |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea |
| SMILES | CCNC(=O)NCc1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C24H20F2N4O/c1-2-27-24(31)28-14-15-3-12-20-21(13-15)30-23(17-6-10-19(26)11-7-17)22(29-20)16-4-8-18(25)9-5-16/h3-13H,2,14H2,1H3,(H2,27,28,31) |
| InChIKey | MLSMAMOJEDDDRK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea?
The IUPAC name of 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea (CID 170297200) is 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea.
What is the SMILES notation for 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea?
The canonical SMILES for 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea is CCNC(=O)NCc1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1.
What is the InChIKey of 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea?
The InChIKey is MLSMAMOJEDDDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20F2N4O/c1-2-27-24(31)28-14-15-3-12-20-21(13-15)30-23(17-6-10-19(26)11-7-17)22(29-20)16-4-8-18(25)9-5-16/h3-13H,2,14H2,1H3,(H2,27,28,31).
What are the key properties of 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea?
1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea has a molecular weight of 418.45 g/mol, XLogP of 5.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]methyl]-3-ethylurea is sourced from PubChem (CID 170297200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).